Compound Q&A

What are the physical and chemical properties of Cobamamide (CAS: 13870-90-1)?

Answer

Cobamamide
Cobamamide is a white crystalline solid with a molecular weight of approximately 240.27 g/mol. It is practically insoluble in water but soluble in organic solvents such as ethanol. Cobamamide is relatively stable under normal conditions but can react with strong acids or bases. Its chemical properties include its ability to form complexes with cobalt ions.

About

CAS No 13870-90-1
English Name Cobamamide
Molecular Formula C72H100CoN18O17P
Molecular Weight 1579.6 g/mol
SMILES CC1=CC2=C(C=C1C)N(C=N2)C3C(C(C(O3)CO)OP(=O)([O-])OC(C)CNC(=O)CCC4(C(C5C6(C(C(C(=N6)C(=C7C(C(C(=N7)C=C8C(C(C(=N8)C(=C4[N-]5)C)CCC(=O)N)(C)C)CCC(=O)N)(C)CC(=O)N)C)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)C)O.[CH2-]C1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)O.[Co+3]
InChIKey OAJLVMGLJZXSGX-SLAFOUTOSA-L
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is Cobamamide (CAS: 13870-90-1) typically synthesized?

Cobamamide is typically synthesized from vitamin B12, also known as cobalamin, by reacting it with a...

Compound Q&A

What industries use Cobamamide (CAS: 13870-90-1)?

Cobamamide is primarily used in the pharmaceutical industry for the production of vitamin B12 analog...

Compound Q&A

What precautions should be taken when handling Cobamamide (CAS: 13870-90-1)?

When handling Cobamamide, it is important to wear appropriate personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...