Compound Q&A

What industries use (+)-Menthyl Chloroformate (CAS: 7635-54-3)?

Answer

(+)-Menthyl Chloroformate
(+)-Menthyl Chloroformate is used in various industries, including pharmaceuticals, where it serves as a precursor for the synthesis of chiral compounds. It is also utilized in the production of polymers for special applications, as a sensor component, and in the synthesis of certain semiconductors. Its ability to form stable esters with high selectivity makes it valuable in these sectors.

About

CAS No 7635-54-3
English Name (+)-Menthyl Chloroformate
Molecular Formula C11H19ClO2
Molecular Weight 218.72 g/mol
SMILES CC1CCC(C(C1)OC(=O)Cl)C(C)C
InChIKey KIUPCUCGVCGPPA-AEJSXWLSSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of (+)-Menthyl Chloroformate (CAS: 7635-54-3)?

The physical and chemical properties of (+)-Menthyl Chloroformate include a crystalline form at room...

Compound Q&A

How is (+)-Menthyl Chloroformate (CAS: 7635-54-3) typically synthesized?

(+)-Menthyl Chloroformate can be synthesized by the reaction of (−)-menthol with thionyl chloride an...

Compound Q&A

What precautions should be taken when handling (+)-Menthyl Chloroformate (CAS: 7635-54-3)?

When handling (+)-Menthyl Chloroformate, it is crucial to use appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...