Compound Q&A

How is (+)-Menthyl Chloroformate (CAS: 7635-54-3) typically synthesized?

Answer

(+)-Menthyl Chloroformate
(+)-Menthyl Chloroformate can be synthesized by the reaction of (−)-menthol with thionyl chloride and subsequent reaction with chloroform. Commonly, thionyl chloride is used to convert menthol to its chloride derivative, which is then reacted with chloroform in the presence of a base or catalyst to form the chloroformate. The process involves selective esterification and can yield up to 95% purity with good yield and selectivity.

About

CAS No 7635-54-3
English Name (+)-Menthyl Chloroformate
Molecular Formula C11H19ClO2
Molecular Weight 218.72 g/mol
SMILES CC1CCC(C(C1)OC(=O)Cl)C(C)C
InChIKey KIUPCUCGVCGPPA-AEJSXWLSSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of (+)-Menthyl Chloroformate (CAS: 7635-54-3)?

The physical and chemical properties of (+)-Menthyl Chloroformate include a crystalline form at room...

Compound Q&A

What industries use (+)-Menthyl Chloroformate (CAS: 7635-54-3)?

(+)-Menthyl Chloroformate is used in various industries, including pharmaceuticals, where it serves...

Compound Q&A

What precautions should be taken when handling (+)-Menthyl Chloroformate (CAS: 7635-54-3)?

When handling (+)-Menthyl Chloroformate, it is crucial to use appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...