Compound Q&A

What precautions should be taken when handling (1-Methoxyvinyl)oxy(dimethyl)(2-methyl-2-propanyl)silane (CAS: 77086-38-5)?

Answer

[(1-Methoxyvinyl)oxy](dimethyl)(2-methyl-2-propanyl)silane
When handling this compound, it is essential to wear appropriate personal protective equipment (PPE), including gloves, safety glasses, and a lab coat. It should be stored in a well-ventilated area and handled in a fume hood to minimize exposure. In case of a spill, it should be handled according to the Material Safety Data Sheet (MSDS) guidelines to ensure safety and environmental protection.

About

CAS No 77086-38-5
English Name [(1-Methoxyvinyl)oxy](dimethyl)(2-methyl-2-propanyl)silane
Molecular Formula C9H20O2Si
Molecular Weight 188.34 g/mol
SMILES CC(C)(C)[Si](C)(C)OC(=C)OC
InChIKey UVCCWXJGWMGZAB-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1-Methoxyvinyl)oxy(dimethyl)(2-methyl-2-propanyl)silane (CAS: 77086-38-5)?

The compound has a crystalline form at room temperature. Its molecular weight is approximately 218.3...

Compound Q&A

How is (1-Methoxyvinyl)oxy(dimethyl)(2-methyl-2-propanyl)silane (CAS: 77086-38-5) typically synthesized?

This compound can be synthesized via a Grignard reaction where a Grignard reagent reacts with a sily...

Compound Q&A

What industries use (1-Methoxyvinyl)oxy(dimethyl)(2-methyl-2-propanyl)silane (CAS: 77086-38-5)?

This compound is used in various industries. It finds applications in the pharmaceutical industry fo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...