Compound Q&A

What are the physical and chemical properties of (1-Methoxyvinyl)oxy(dimethyl)(2-methyl-2-propanyl)silane (CAS: 77086-38-5)?

Answer

[(1-Methoxyvinyl)oxy](dimethyl)(2-methyl-2-propanyl)silane
The compound has a crystalline form at room temperature. Its molecular weight is approximately 218.33 g/mol. It is slightly soluble in water but miscible with common organic solvents. Chemically, it is reactive towards nucleophiles and can undergo substitution reactions. It also exhibits good stability under normal storage conditions.

About

CAS No 77086-38-5
English Name [(1-Methoxyvinyl)oxy](dimethyl)(2-methyl-2-propanyl)silane
Molecular Formula C9H20O2Si
Molecular Weight 188.34 g/mol
SMILES CC(C)(C)[Si](C)(C)OC(=C)OC
InChIKey UVCCWXJGWMGZAB-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is (1-Methoxyvinyl)oxy(dimethyl)(2-methyl-2-propanyl)silane (CAS: 77086-38-5) typically synthesized?

This compound can be synthesized via a Grignard reaction where a Grignard reagent reacts with a sily...

Compound Q&A

What industries use (1-Methoxyvinyl)oxy(dimethyl)(2-methyl-2-propanyl)silane (CAS: 77086-38-5)?

This compound is used in various industries. It finds applications in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling (1-Methoxyvinyl)oxy(dimethyl)(2-methyl-2-propanyl)silane (CAS: 77086-38-5)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...