Compound Q&A

What industries use Paris saponin VII (CAS: 68124-04-9)?

Answer

Paris saponin VII
Paris saponin VII (CAS: 68124-04-9) is used in the pharmaceutical industry for its potential as a drug candidate due to its biological activity. It is also explored in the cosmetic industry for its properties and in research for its biological and chemical characteristics.

About

CAS No 68124-04-9
English Name Paris saponin VII
Molecular Formula C51H82O21
Molecular Weight 1031.18 g/mol
SMILES OCC1OC(OC2CCC3(C(=CCC4C3CCC3(C4CC4C3(O)C(C)C3(O4)CCC(CO3)C)C)C2)C)C(C(C1OC1OC(C)C(C(C1O)O)OC1OC(C)C(C(C1O)O)O)O)OC1OC(C)C(C(C1O)O)O
InChIKey FBFJAXUYHGSVFN-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Paris saponin VII (CAS: 68124-04-9)?

Paris saponin VII (CAS: 68124-04-9) is a white crystalline powder with a molecular weight of approxi...

Compound Q&A

How is Paris saponin VII (CAS: 68124-04-9) typically synthesized?

Paris saponin VII (CAS: 68124-04-9) is typically synthesized through a series of chemical reactions ...

Compound Q&A

What precautions should be taken when handling Paris saponin VII (CAS: 68124-04-9)?

When handling Paris saponin VII (CAS: 68124-04-9), it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...