Compound Q&A

How is Paris saponin VII (CAS: 68124-04-9) typically synthesized?

Answer

Paris saponin VII
Paris saponin VII (CAS: 68124-04-9) is typically synthesized through a series of chemical reactions involving saponin extraction, isolation, and purification. Common methods include acid hydrolysis, esterification, and chromatographic separation. The reaction usually involves the use of a strong acid and subsequent derivatization steps.

About

CAS No 68124-04-9
English Name Paris saponin VII
Molecular Formula C51H82O21
Molecular Weight 1031.18 g/mol
SMILES OCC1OC(OC2CCC3(C(=CCC4C3CCC3(C4CC4C3(O)C(C)C3(O4)CCC(CO3)C)C)C2)C)C(C(C1OC1OC(C)C(C(C1O)O)OC1OC(C)C(C(C1O)O)O)O)OC1OC(C)C(C(C1O)O)O
InChIKey FBFJAXUYHGSVFN-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Paris saponin VII (CAS: 68124-04-9)?

Paris saponin VII (CAS: 68124-04-9) is a white crystalline powder with a molecular weight of approxi...

Compound Q&A

What industries use Paris saponin VII (CAS: 68124-04-9)?

Paris saponin VII (CAS: 68124-04-9) is used in the pharmaceutical industry for its potential as a dr...

Compound Q&A

What precautions should be taken when handling Paris saponin VII (CAS: 68124-04-9)?

When handling Paris saponin VII (CAS: 68124-04-9), it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...