Compound Q&A

How is ethylene glycol (CAS: 9082-00-2) typically synthesized?

Answer

ethylene glycol;glycerol;propane-1,2-diol
Ethylene glycol (CAS: 9082-00-2) is typically synthesized through the hydration of ethylene oxide. The reaction is catalyzed by acidic or basic catalysts, with sulfuric acid being the most common. The process involves the conversion of ethylene oxide to ethylene glycol with high selectivity and yield, often in the range of 90-95%. An alternative method involves the direct hydration of ethylene, but this is less common and more challenging.

About

CAS No 9082-00-2
English Name ethylene glycol;glycerol;propane-1,2-diol
Molecular Formula C8H22O7
Molecular Weight 230.26 g/mol
SMILES CC(CO)O.C(CO)O.C(C(CO)O)O
InChIKey VKVYTKULMKDWLP-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of ethylene glycol (CAS: 9082-00-2)?

Ethylene glycol (CAS: 9082-00-2) is a colorless, viscous, sweet-tasting liquid with a slight odor. I...

Compound Q&A

What industries use ethylene glycol (CAS: 9082-00-2)?

Ethylene glycol (CAS: 9082-00-2) is widely used in various industries. It is a key component in anti...

Compound Q&A

What precautions should be taken when handling ethylene glycol (CAS: 9082-00-2)?

When handling ethylene glycol (CAS: 9082-00-2), it is important to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...