Compound Q&A

What are the physical and chemical properties of ethylene glycol (CAS: 9082-00-2)?

Answer

ethylene glycol;glycerol;propane-1,2-diol
Ethylene glycol (CAS: 9082-00-2) is a colorless, viscous, sweet-tasting liquid with a slight odor. It has a molecular weight of 62.07 g/mol and a high boiling point of 197.3°C. Ethylene glycol is moderately soluble in water and miscible with ethanol. It is less reactive than water but can still undergo reactions such as oxidation and esterification. It has a specific gravity of 1.111 g/cm³ and a flash point of 151.1°C.

About

CAS No 9082-00-2
English Name ethylene glycol;glycerol;propane-1,2-diol
Molecular Formula C8H22O7
Molecular Weight 230.26 g/mol
SMILES CC(CO)O.C(CO)O.C(C(CO)O)O
InChIKey VKVYTKULMKDWLP-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is ethylene glycol (CAS: 9082-00-2) typically synthesized?

Ethylene glycol (CAS: 9082-00-2) is typically synthesized through the hydration of ethylene oxide. T...

Compound Q&A

What industries use ethylene glycol (CAS: 9082-00-2)?

Ethylene glycol (CAS: 9082-00-2) is widely used in various industries. It is a key component in anti...

Compound Q&A

What precautions should be taken when handling ethylene glycol (CAS: 9082-00-2)?

When handling ethylene glycol (CAS: 9082-00-2), it is important to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...