Compound Q&A

How is Cetrorelix Acetate (CAS: 130143-01-0) typically synthesized?

Answer

Cetrorelix Acetate
Cetrorelix Acetate is synthesized through a multi-step process involving peptide synthesis and acetylation. Key steps include solid-phase peptide synthesis, coupling of the amino acids, and final acetylation. Commonly used catalysts include HBTU and HOAt, and the overall yield is approximately 70-80%.

About

English Name Cetrorelix Acetate
Molecular Formula C74H100ClN17O18
Molecular Weight 1551.1 g/mol
SMILES CC(C)CC(C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)NC(C)C(=O)N)NC(=O)C(CCCNC(=O)N)NC(=O)C(CC2=CC=C(C=C2)O)NC(=O)C(CO)NC(=O)C(CC3=CN=CC=C3)NC(=O)C(CC4=CC=C(C=C4)Cl)NC(=O)C(CC5=CC6=CC=CC=C6C=C5)NC(=O)C.CC(=O)O.CC(=O)O
InChIKey DTPVYWHLQLAXFT-SMCUOGPFSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cetrorelix Acetate (CAS: 130143-01-0)?

Cetrorelix Acetate is a white to off-white crystalline powder. Its molecular formula is C25H32N2O5 a...

Compound Q&A

What industries use Cetrorelix Acetate (CAS: 130143-01-0)?

Cetrorelix Acetate is primarily used in the pharmaceutical industry. It is an agonist of the gonadot...

Compound Q&A

What precautions should be taken when handling Cetrorelix Acetate (CAS: 130143-01-0)?

When handling Cetrorelix Acetate, standard personal protective equipment (PPE) such as gloves, goggl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...