Compound Q&A

How is 1-Phenylcyclopentanecarbonitrile (CAS: 77-57-6) typically synthesized?

Answer

1-Phenylcyclopentanecarbonitrile
1-Phenylcyclopentanecarbonitrile is typically synthesized by the reaction of phenylcyclopentane with hydrogen cyanide. Commonly, this reaction is conducted in the presence of a catalyst like palladium on carbon under pressure. The yield is generally high, and the product can be isolated by simple distillation. The reaction conditions include a temperature range of 50-60°C and a pressure of 2-3 atm. This method ensures high selectivity and purity of the product.

About

CAS No 77-57-6
English Name 1-Phenylcyclopentanecarbonitrile
Molecular Formula C12H13N
Molecular Weight 17.03 g/mol
SMILES C1CCC(C1)(C#N)C2=CC=CC=C2
InChIKey GDXMFFGTPGAGGX-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Phenylcyclopentanecarbonitrile (CAS: 77-57-6)?

1-Phenylcyclopentanecarbonitrile is a colorless to light yellow crystalline solid with a molecular w...

Compound Q&A

What industries use 1-Phenylcyclopentanecarbonitrile (CAS: 77-57-6)?

1-Phenylcyclopentanecarbonitrile is used in various industries. It is primarily used in the pharmace...

Compound Q&A

What precautions should be taken when handling 1-Phenylcyclopentanecarbonitrile (CAS: 77-57-6)?

When handling 1-Phenylcyclopentanecarbonitrile, it is essential to follow strict safety protocols. W...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...