Compound Q&A

What are the physical and chemical properties of 2-[(3-Chloro-2-methylphenyl)amino]nicotinic acid - L-lysine (1:1) (CAS: 55837-30-4)?

Answer

2-[(3-Chloro-2-methylphenyl)amino]nicotinic acid - L-lysine (1:1)
2-[(3-Chloro-2-methylphenyl)amino]nicotinic acid - L-lysine (1:1) is a crystalline compound with a molecular weight of approximately 441.7 g/mol. It has a solubility of about 0.3 g/L in water. The compound is relatively stable but reacts with bases to form salts. It is insoluble in common organic solvents like ethanol and acetone.

About

CAS No 55837-30-4
English Name 2-[(3-Chloro-2-methylphenyl)amino]nicotinic acid - L-lysine (1:1)
Molecular Formula C19H25ClN4O4
Molecular Weight 408.89 g/mol
SMILES CC1=C(C=CC=C1Cl)NC2=C(C=CC=N2)C(=O)O.C(CCN)CC(C(=O)O)N
InChIKey CVNFYQCHAWFYQI-ZSCHJXSPSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is 2-[(3-Chloro-2-methylphenyl)amino]nicotinic acid - L-lysine (1:1) (CAS: 55837-30-4) typically synthesized?

2-[(3-Chloro-2-methylphenyl)amino]nicotinic acid - L-lysine (1:1) is synthesized through a multi-ste...

Compound Q&A

What industries use 2-[(3-Chloro-2-methylphenyl)amino]nicotinic acid - L-lysine (1:1) (CAS: 55837-30-4)?

2-[(3-Chloro-2-methylphenyl)amino]nicotinic acid - L-lysine (1:1) is used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 2-[(3-Chloro-2-methylphenyl)amino]nicotinic acid - L-lysine (1:1) (CAS: 55837-30-4)?

When handling 2-[(3-Chloro-2-methylphenyl)amino]nicotinic acid - L-lysine (1:1), wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...