Compound Q&A

What industries use 1,2-Naphthalenedione (CAS: 524-42-5)?

Answer

1,2-Naphthalenedione
1,2-Naphthalenedione (CAS: 524-42-5) is used in various industries. It is a key intermediate in the synthesis of pharmaceuticals, where it contributes to the development of anti-inflammatory and analgesic drugs. It also finds applications in the production of dyes and pigments, as well as in the development of sensors and semiconductors due to its unique optical and electronic properties.

About

CAS No 524-42-5
English Name 1,2-Naphthalenedione
Molecular Formula C10H6O2
Molecular Weight 158.16 g/mol
SMILES C1=CC=C2C(=C1)C=CC(=O)C2=O
InChIKey KETQAJRQOHHATG-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2-Naphthalenedione (CAS: 524-42-5)?

1,2-Naphthalenedione (CAS: 524-42-5) is a crystalline compound with a molecular weight of 148.13 g/m...

Compound Q&A

How is 1,2-Naphthalenedione (CAS: 524-42-5) typically synthesized?

1,2-Naphthalenedione (CAS: 524-42-5) is often synthesized via the oximation process, where naphthald...

Compound Q&A

What precautions should be taken when handling 1,2-Naphthalenedione (CAS: 524-42-5)?

When handling 1,2-Naphthalenedione (CAS: 524-42-5), it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...