Compound Q&A

How is 1,2-Naphthalenedione (CAS: 524-42-5) typically synthesized?

Answer

1,2-Naphthalenedione
1,2-Naphthalenedione (CAS: 524-42-5) is often synthesized via the oximation process, where naphthaldehyde is treated with an oxidizing agent such as potassium permanganate or potassium dichromate in an acidic medium. This process yields high purity compounds with good selectivity and yield. Additionally, it can be prepared by the condensation reaction of naphthylamine and formaldehyde in the presence of an acid catalyst.

About

CAS No 524-42-5
English Name 1,2-Naphthalenedione
Molecular Formula C10H6O2
Molecular Weight 158.16 g/mol
SMILES C1=CC=C2C(=C1)C=CC(=O)C2=O
InChIKey KETQAJRQOHHATG-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2-Naphthalenedione (CAS: 524-42-5)?

1,2-Naphthalenedione (CAS: 524-42-5) is a crystalline compound with a molecular weight of 148.13 g/m...

Compound Q&A

What industries use 1,2-Naphthalenedione (CAS: 524-42-5)?

1,2-Naphthalenedione (CAS: 524-42-5) is used in various industries. It is a key intermediate in the ...

Compound Q&A

What precautions should be taken when handling 1,2-Naphthalenedione (CAS: 524-42-5)?

When handling 1,2-Naphthalenedione (CAS: 524-42-5), it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...