Compound Q&A

What industries use 4-Phenyl-1,2,4-triazolidine-3,5-dione (CAS: 15988-11-1)?

Answer

4-Phenyl-1,2,4-triazolidine-3,5-dione
4-Phenyl-1,2,4-triazolidine-3,5-dione is used in various industries. It is a key intermediate in the synthesis of pharmaceuticals, particularly as a precursor in the production of bioactive compounds. It is also used in the polymer industry for the modification of polymers and in the development of sensors for detecting specific chemical species. Its functional groups make it useful in semiconductor applications as well.

About

CAS No 15988-11-1
English Name 4-Phenyl-1,2,4-triazolidine-3,5-dione
Molecular Formula C8H7N3O2
Molecular Weight 177.16 g/mol
SMILES C1=CC=C(C=C1)N2C(=O)NNC2=O
InChIKey GOSUFRDROXZXLN-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Phenyl-1,2,4-triazolidine-3,5-dione (CAS: 15988-11-1)?

4-Phenyl-1,2,4-triazolidine-3,5-dione is a solid with a crystalline form. Its molecular weight is ap...

Compound Q&A

How is 4-Phenyl-1,2,4-triazolidine-3,5-dione (CAS: 15988-11-1) typically synthesized?

4-Phenyl-1,2,4-triazolidine-3,5-dione is typically synthesized via the reaction of phenylhydrazine a...

Compound Q&A

What precautions should be taken when handling 4-Phenyl-1,2,4-triazolidine-3,5-dione (CAS: 15988-11-1)?

When handling 4-Phenyl-1,2,4-triazolidine-3,5-dione, it is important to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...