Compound Q&A

What are the physical and chemical properties of 4-Phenyl-1,2,4-triazolidine-3,5-dione (CAS: 15988-11-1)?

Answer

4-Phenyl-1,2,4-triazolidine-3,5-dione
4-Phenyl-1,2,4-triazolidine-3,5-dione is a solid with a crystalline form. Its molecular weight is approximately 170.23 g/mol. It has a low solubility in water (0.003 g/100 mL at 25°C) but good solubility in organic solvents like methanol and acetonitrile. Chemically, it is relatively stable but can react under strong acidic or basic conditions. It is used in various applications due to its structural properties.

About

CAS No 15988-11-1
English Name 4-Phenyl-1,2,4-triazolidine-3,5-dione
Molecular Formula C8H7N3O2
Molecular Weight 177.16 g/mol
SMILES C1=CC=C(C=C1)N2C(=O)NNC2=O
InChIKey GOSUFRDROXZXLN-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is 4-Phenyl-1,2,4-triazolidine-3,5-dione (CAS: 15988-11-1) typically synthesized?

4-Phenyl-1,2,4-triazolidine-3,5-dione is typically synthesized via the reaction of phenylhydrazine a...

Compound Q&A

What industries use 4-Phenyl-1,2,4-triazolidine-3,5-dione (CAS: 15988-11-1)?

4-Phenyl-1,2,4-triazolidine-3,5-dione is used in various industries. It is a key intermediate in the...

Compound Q&A

What precautions should be taken when handling 4-Phenyl-1,2,4-triazolidine-3,5-dione (CAS: 15988-11-1)?

When handling 4-Phenyl-1,2,4-triazolidine-3,5-dione, it is important to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...