Compound Q&A

What are the physical and chemical properties of 4-Methoxy-N-phenylaniline (CAS: 1208-86-2)?

Answer

4-Methoxy-N-phenylaniline
4-Methoxy-N-phenylaniline (CAS: 1208-86-2) is a white crystalline solid with a molecular weight of approximately 194.21 g/mol. It has a melting point of 59-61°C and is slightly soluble in water. Chemically, it is less reactive than its parent compound but can undergo electrophilic aromatic substitution reactions. It is insoluble in most common organic solvents, making it useful for certain purification and synthesis steps.

About

CAS No 1208-86-2
English Name 4-Methoxy-N-phenylaniline
Molecular Formula C13H13NO
Molecular Weight 199.25 g/mol
SMILES COC1=CC=C(C=C1)NC2=CC=CC=C2
InChIKey OBHGSIGHEBGGFS-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is 4-Methoxy-N-phenylaniline (CAS: 1208-86-2) typically synthesized?

4-Methoxy-N-phenylaniline is typically synthesized from p-aminophenol and methanol via a methylation...

Compound Q&A

What industries use 4-Methoxy-N-phenylaniline (CAS: 1208-86-2)?

4-Methoxy-N-phenylaniline (CAS: 1208-86-2) is primarily used in the pharmaceutical industry as a pre...

Compound Q&A

What precautions should be taken when handling 4-Methoxy-N-phenylaniline (CAS: 1208-86-2)?

When handling 4-Methoxy-N-phenylaniline (CAS: 1208-86-2), it is important to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...