Compound Q&A

What industries use (S)-tert-Butyl 5-azaspiro[2.4]heptan-7-ylcarbamate (CAS: 127199-45-5)?

Answer

(S)-tert-Butyl 5-azaspiro[2.4]heptan-7-ylcarbamate
(S)-tert-Butyl 5-azaspiro[2.4]heptan-7-ylcarbamate is primarily used in the pharmaceutical industry for the synthesis of drugs and intermediates. It is also explored in the polymer industry for its potential applications in the development of functional polymers and materials. Additionally, it has shown promise in the sensor and semiconductor industries for its reactivity and stability.

About

English Name (S)-tert-Butyl 5-azaspiro[2.4]heptan-7-ylcarbamate
Molecular Formula C11H20N2O2
Molecular Weight 212.29 g/mol
SMILES CC(C)(C)OC(=O)NC1CNCC12CC2
InChIKey CGEBPOMWRHSMLI-MRVPVSSYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-tert-Butyl 5-azaspiro[2.4]heptan-7-ylcarbamate (CAS: 127199-45-5)?

(S)-tert-Butyl 5-azaspiro[2.4]heptan-7-ylcarbamate is a white crystalline solid with a molecular wei...

Compound Q&A

How is (S)-tert-Butyl 5-azaspiro[2.4]heptan-7-ylcarbamate (CAS: 127199-45-5) typically synthesized?

(S)-tert-Butyl 5-azaspiro[2.4]heptan-7-ylcarbamate can be synthesized through a multi-step process i...

Compound Q&A

What precautions should be taken when handling (S)-tert-Butyl 5-azaspiro[2.4]heptan-7-ylcarbamate (CAS: 127199-45-5)?

When handling (S)-tert-Butyl 5-azaspiro[2.4]heptan-7-ylcarbamate, it is important to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...