Compound Q&A

What industries utilize 2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde (CAS: 1228837-05-5)?

Answer

2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde
2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde (CAS: 1228837-05-5) finds application in the pharmaceutical industry, where it is used as a precursor for the synthesis of various drugs. It is also utilized in the production of polymers and as a component in sensor technology due to its unique chemical properties.

About

English Name 2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde
Molecular Formula C15H17ClO
Molecular Weight 248.75 g/mol
SMILES CC1(C)CCC(=C(C1)c2ccc(Cl)cc2)C=O
InChIKey OOUSVDAPSBFSBR-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde (CAS: 1228837-05-5)?

2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde (CAS: 1228837-05-5) is a white crystall...

Compound Q&A

How is 2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde (CAS: 1228837-05-5) typically synthesized?

2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde (CAS: 1228837-05-5) is typically synthe...

Compound Q&A

What precautions should be taken when handling 2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde (CAS: 1228837-05-5)?

When handling 2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde (CAS: 1228837-05-5), it i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...