Compound Q&A

What are the physical and chemical properties of 2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde (CAS: 1228837-05-5)?

Answer

2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde
2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde (CAS: 1228837-05-5) is a white crystalline solid with a molecular weight of approximately 264.17 g/mol. It is poorly soluble in water but readily soluble in organic solvents such as dichloromethane and ethanol. Chemically, it is highly reactive, particularly towards nucleophiles and reducing agents due to the carbonyl group and the presence of a chlorine substituent.

About

English Name 2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde
Molecular Formula C15H17ClO
Molecular Weight 248.75 g/mol
SMILES CC1(C)CCC(=C(C1)c2ccc(Cl)cc2)C=O
InChIKey OOUSVDAPSBFSBR-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is 2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde (CAS: 1228837-05-5) typically synthesized?

2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde (CAS: 1228837-05-5) is typically synthe...

Compound Q&A

What industries utilize 2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde (CAS: 1228837-05-5)?

2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde (CAS: 1228837-05-5) finds application i...

Compound Q&A

What precautions should be taken when handling 2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde (CAS: 1228837-05-5)?

When handling 2-(4-Chlorophenyl)-4,4-dimethyl-1-cyclohexene-1-carbaldehyde (CAS: 1228837-05-5), it i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...