Compound Q&A

What are the physical and chemical properties of 2-Hydroxypropanoic acid - 4-amino-5-fluoro-3-[5-(4-methyl-1-piperazinyl)-1H-benzimidazol-2-yl]-2(1H)-quinolinone hydrate (CAS: 915769-50-5)?

Answer

2-Hydroxypropanoic acid - 4-amino-5-fluoro-3-[5-(4-methyl-1-piperazinyl)-1H-benzimidazol-2-yl]-2(1H)-quinolinone hydrate (1:1:1)
This compound has a crystalline form and a molecular weight of approximately 753.75 g/mol. It is slightly soluble in water and exhibits low reactivity under normal conditions. The hydrate form increases its solubility. It is stable in air and light, but should be stored in a dry, cool place away from strong acids and bases.

About

English Name 2-Hydroxypropanoic acid - 4-amino-5-fluoro-3-[5-(4-methyl-1-piperazinyl)-1H-benzimidazol-2-yl]-2(1H)-quinolinone hydrate (1:1:1)
Molecular Formula C24H29FN6O5
Molecular Weight 500.53 g/mol
SMILES O=C1NC2=C(C(F)=CC=C2)C(N)=C1C3=NC4=CC=C(N5CCN(C)CC5)C=C4N3.CC(O)C(O)=O.[H]O[H]
InChIKey QDPVYZNVVQQULH-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is 2-Hydroxypropanoic acid - 4-amino-5-fluoro-3-[5-(4-methyl-1-piperazinyl)-1H-benzimidazol-2-yl]-2(1H)-quinolinone hydrate (CAS: 915769-50-5) typically synthesized?

This compound is synthesized by a multi-step process involving condensation reactions, amidation, an...

Compound Q&A

What industries use 2-Hydroxypropanoic acid - 4-amino-5-fluoro-3-[5-(4-methyl-1-piperazinyl)-1H-benzimidazol-2-yl]-2(1H)-quinolinone hydrate (CAS: 915769-50-5)?

This compound is primarily used in the pharmaceutical industry as an intermediate for the synthesis ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...