Compound Q&A

How is Cefpodoxime Acid (CAS: 80210-62-4) typically synthesized?

Answer

Cefpodoxime Acid
Cefpodoxime acid is typically synthesized via a multi-step process involving the reaction of 7-ACA (7-aminocephalosporanic acid) with 4-chlorobenzyl chloromethyl ketone, followed by acidification. This process requires careful control of pH and temperature to achieve high yield and selectivity.

About

CAS No 80210-62-4
English Name Cefpodoxime Acid
Molecular Formula C15H17N5O6S2
Molecular Weight 427.46 g/mol
SMILES COCC1=C(N2C(C(C2=O)NC(=O)C(=NOC)C3=CSC(=N3)N)SC1)C(=O)O
InChIKey WYUSVOMTXWRGEK-HBWVYFAYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cefpodoxime Acid (CAS: 80210-62-4)?

Cefpodoxime acid is a crystalline compound with a molecular weight of approximately 346.36 g/mol. It...

Compound Q&A

What industries use Cefpodoxime Acid (CAS: 80210-62-4)?

Cefpodoxime acid is primarily used in the pharmaceutical industry as an intermediate for the synthes...

Compound Q&A

What precautions should be taken when handling Cefpodoxime Acid (CAS: 80210-62-4)?

When handling cefpodoxime acid, it is essential to wear appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...