Compound Q&A

How is [(Diphenylmethyl)sulfanyl]acetic acid (CAS: 63547-22-8) typically synthesized?

Answer

[(Diphenylmethyl)sulfanyl]acetic acid
[(Diphenylmethyl)sulfanyl]acetic acid can be synthesized through the amidation of diphenylmethanethiol with acetic anhydride. Common catalysts include 4-dimethylaminopyridine (DMAP) to improve the yield and selectivity. The reaction typically proceeds with a yield of around 70-80%, depending on the purity of starting materials.

About

CAS No 63547-22-8
English Name [(Diphenylmethyl)sulfanyl]acetic acid
Molecular Formula C15H14O2S
Molecular Weight 258.34 g/mol
SMILES C1=CC=C(C=C1)C(C2=CC=CC=C2)SCC(=O)O
InChIKey HTHFEDOFDBZPRX-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of [(Diphenylmethyl)sulfanyl]acetic acid (CAS: 63547-22-8)?

[(Diphenylmethyl)sulfanyl]acetic acid is a white to off-white solid with a molecular weight of appro...

Compound Q&A

What industries use [(Diphenylmethyl)sulfanyl]acetic acid (CAS: 63547-22-8)?

[(Diphenylmethyl)sulfanyl]acetic acid finds applications in pharmaceuticals for its potential as a p...

Compound Q&A

What precautions should be taken when handling [(Diphenylmethyl)sulfanyl]acetic acid (CAS: 63547-22-8)?

When handling [(Diphenylmethyl)sulfanyl]acetic acid, it is crucial to use appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...