Compound Q&A

What are the physical and chemical properties of [(Diphenylmethyl)sulfanyl]acetic acid (CAS: 63547-22-8)?

Answer

[(Diphenylmethyl)sulfanyl]acetic acid
[(Diphenylmethyl)sulfanyl]acetic acid is a white to off-white solid with a molecular weight of approximately 286.33 g/mol. It has a melting point of around 135-139°C and is sparingly soluble in water. Chemically, it is relatively stable but reacts readily with strong acids and bases. It is used in various applications due to its unique reactivity and structural features.

About

CAS No 63547-22-8
English Name [(Diphenylmethyl)sulfanyl]acetic acid
Molecular Formula C15H14O2S
Molecular Weight 258.34 g/mol
SMILES C1=CC=C(C=C1)C(C2=CC=CC=C2)SCC(=O)O
InChIKey HTHFEDOFDBZPRX-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is [(Diphenylmethyl)sulfanyl]acetic acid (CAS: 63547-22-8) typically synthesized?

[(Diphenylmethyl)sulfanyl]acetic acid can be synthesized through the amidation of diphenylmethanethi...

Compound Q&A

What industries use [(Diphenylmethyl)sulfanyl]acetic acid (CAS: 63547-22-8)?

[(Diphenylmethyl)sulfanyl]acetic acid finds applications in pharmaceuticals for its potential as a p...

Compound Q&A

What precautions should be taken when handling [(Diphenylmethyl)sulfanyl]acetic acid (CAS: 63547-22-8)?

When handling [(Diphenylmethyl)sulfanyl]acetic acid, it is crucial to use appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...