Compound Q&A

How is 4,6-Dichloropicolinic acid (CAS: 88912-25-8) typically synthesized?

Answer

4,6-Dichloropicolinic acid
4,6-Dichloropicolinic acid is typically synthesized via the chlorination of picolinic acid. This process involves the reaction of picolinic acid with chlorine gas in the presence of a suitable catalyst, such as ferric chloride. The reaction is carried out at a temperature of around 50-60°C, and the yield can be up to 85%.

About

CAS No 88912-25-8
English Name 4,6-Dichloropicolinic acid
Molecular Formula C6H3Cl2NO2
Molecular Weight 192 g/mol
SMILES C1=C(C=C(N=C1C(=O)O)Cl)Cl
InChIKey AYYUSDKNXRPJBH-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,6-Dichloropicolinic acid (CAS: 88912-25-8)?

4,6-Dichloropicolinic acid is a white crystalline solid with a molecular weight of 214.02 g/mol. It ...

Compound Q&A

What industries use 4,6-Dichloropicolinic acid (CAS: 88912-25-8)?

4,6-Dichloropicolinic acid is used in various industries, including pharmaceuticals for intermediate...

Compound Q&A

What precautions should be taken when handling 4,6-Dichloropicolinic acid (CAS: 88912-25-8)?

When handling 4,6-Dichloropicolinic acid, it is essential to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...