Compound Q&A

What industries use 2-Chloro-1,5-dinitro-3-(trifluoromethyl)benzene (CAS: 392-95-0)?

Answer

2-Chloro-1,5-dinitro-3-(trifluoromethyl)benzene
2-Chloro-1,5-dinitro-3-(trifluoromethyl)benzene is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those involving nitro and halogen functionalities. It is also utilized in the polymer and semiconductor industries for specific applications requiring high reactivity and stability.

About

CAS No 392-95-0
English Name 2-Chloro-1,5-dinitro-3-(trifluoromethyl)benzene
Molecular Formula C7H2ClF3N2O4
Molecular Weight 270.55 g/mol
SMILES C1=C(C=C(C(=C1C(F)(F)F)Cl)[N+](=O)[O-])[N+](=O)[O-]
InChIKey RLXKADBMLQPLDV-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-1,5-dinitro-3-(trifluoromethyl)benzene (CAS: 392-95-0)?

2-Chloro-1,5-dinitro-3-(trifluoromethyl)benzene is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 2-Chloro-1,5-dinitro-3-(trifluoromethyl)benzene (CAS: 392-95-0) typically synthesized?

2-Chloro-1,5-dinitro-3-(trifluoromethyl)benzene is usually synthesized by nitration of 2-chloro-1,3-...

Compound Q&A

What precautions should be taken when handling 2-Chloro-1,5-dinitro-3-(trifluoromethyl)benzene (CAS: 392-95-0)?

Handling 2-Chloro-1,5-dinitro-3-(trifluoromethyl)benzene requires strict safety measures. Wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...