Compound Q&A

What precautions should be taken when handling 4-Acetylphenyl acetate (CAS: 13031-43-1)?

Answer

4-Acetylphenyl acetate
When handling 4-Acetylphenyl acetate (CAS: 13031-43-1), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up promptly using appropriate absorbent materials. Refer to the Material Safety Data Sheet (MSDS) for detailed emergency procedures and safety measures.

About

CAS No 13031-43-1
English Name 4-Acetylphenyl acetate
Molecular Formula C10H10O3
Molecular Weight 178.19 g/mol
SMILES CC(=O)C1=CC=C(C=C1)OC(=O)C
InChIKey SMIOEQSLJNNKQF-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Acetylphenyl acetate (CAS: 13031-43-1)?

4-Acetylphenyl acetate (CAS: 13031-43-1) is a crystalline compound with a molecular weight of approx...

Compound Q&A

How is 4-Acetylphenyl acetate (CAS: 13031-43-1) typically synthesized?

4-Acetylphenyl acetate is typically synthesized via the acetylation of 4-acetylphenol using acetic a...

Compound Q&A

What industries use 4-Acetylphenyl acetate (CAS: 13031-43-1)?

4-Acetylphenyl acetate is primarily used in the pharmaceutical and chemical industries. It serves as...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...