Compound Q&A

How is 4-Acetylphenyl acetate (CAS: 13031-43-1) typically synthesized?

Answer

4-Acetylphenyl acetate
4-Acetylphenyl acetate is typically synthesized via the acetylation of 4-acetylphenol using acetic anhydride in the presence of an acid catalyst. The reaction is carried out under mild conditions and provides a high yield. The selectivity is generally good, and the product can be isolated by simple recrystallization.

About

CAS No 13031-43-1
English Name 4-Acetylphenyl acetate
Molecular Formula C10H10O3
Molecular Weight 178.19 g/mol
SMILES CC(=O)C1=CC=C(C=C1)OC(=O)C
InChIKey SMIOEQSLJNNKQF-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Acetylphenyl acetate (CAS: 13031-43-1)?

4-Acetylphenyl acetate (CAS: 13031-43-1) is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use 4-Acetylphenyl acetate (CAS: 13031-43-1)?

4-Acetylphenyl acetate is primarily used in the pharmaceutical and chemical industries. It serves as...

Compound Q&A

What precautions should be taken when handling 4-Acetylphenyl acetate (CAS: 13031-43-1)?

When handling 4-Acetylphenyl acetate (CAS: 13031-43-1), it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...