Compound Q&A

What industries use (3R)-4-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-morpholinecarboxylic acid (CAS: 869681-70-9)?

Answer

(3R)-4-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-morpholinecarboxylic acid
This compound is primarily used in the pharmaceutical industry for the synthesis of bioactive molecules. It also finds applications in polymer chemistry, where it can be used as a monomer or additive. Additionally, it is utilized in the formulation of certain sensors and as a precursor in semiconductor manufacturing.

About

English Name (3R)-4-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-morpholinecarboxylic acid
Molecular Formula C10H17NO5
Molecular Weight 231.25 g/mol
SMILES CC(C)(C)OC(=O)N1CCOC[C@@H]1C(=O)O
InChIKey KVXXEKIGMOEPSA-SSDOTTSWSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3R)-4-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-morpholinecarboxylic acid (CAS: 869681-70-9)?

This compound is a white crystalline solid with a molecular weight of approximately 264.36 g/mol. It...

Compound Q&A

How is (3R)-4-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-morpholinecarboxylic acid (CAS: 869681-70-9) typically synthesized?

This compound can be synthesized via a multi-step process starting with morpholine and 2-methyl-2-pr...

Compound Q&A

What precautions should be taken when handling (3R)-4-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-morpholinecarboxylic acid (CAS: 869681-70-9)?

Proper handling procedures include the use of gloves, safety goggles, and a lab coat. Store the comp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...