Compound Q&A

How is (3R)-4-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-morpholinecarboxylic acid (CAS: 869681-70-9) typically synthesized?

Answer

(3R)-4-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-morpholinecarboxylic acid
This compound can be synthesized via a multi-step process starting with morpholine and 2-methyl-2-propanol. The key steps involve esterification followed by protection and deprotection of functional groups. Commonly used reagents include acyl chlorides or mixed anhydrides, with HBTU or EDC as coupling agents. The overall yield is moderate to good, depending on the purity of the intermediates.

About

English Name (3R)-4-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-morpholinecarboxylic acid
Molecular Formula C10H17NO5
Molecular Weight 231.25 g/mol
SMILES CC(C)(C)OC(=O)N1CCOC[C@@H]1C(=O)O
InChIKey KVXXEKIGMOEPSA-SSDOTTSWSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3R)-4-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-morpholinecarboxylic acid (CAS: 869681-70-9)?

This compound is a white crystalline solid with a molecular weight of approximately 264.36 g/mol. It...

Compound Q&A

What industries use (3R)-4-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-morpholinecarboxylic acid (CAS: 869681-70-9)?

This compound is primarily used in the pharmaceutical industry for the synthesis of bioactive molecu...

Compound Q&A

What precautions should be taken when handling (3R)-4-{[(2-Methyl-2-propanyl)oxy]carbonyl}-3-morpholinecarboxylic acid (CAS: 869681-70-9)?

Proper handling procedures include the use of gloves, safety goggles, and a lab coat. Store the comp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...