Compound Q&A

Is 2-Iodobenzenesulfonic acid (CAS: 63059-25-6) safe?

Answer

2-Iodobenzenesulfonic acid
2-Iodobenzenesulfonic acid (CAS: 63059-25-6) is generally considered safe when handled with appropriate precautions. It is corrosive and can irritate the skin and eyes. Proper protective equipment, such as gloves and goggles, should be worn during handling. Avoid contact with water, as it can cause the release of toxic gases.

About

CAS No 63059-25-6
English Name 2-Iodobenzenesulfonic acid
Molecular Formula C6H5IO3S
Molecular Weight 284.07 g/mol
SMILES C1=CC=C(C(=C1)S(=O)(=O)O)I
InChIKey ZJTNYBYLBTVLRD-UHFFFAOYSA-N
Last Updated: 2025-10-06 18:01

Related Q&A

Compound Q&A

What is 2-Iodobenzenesulfonic acid (CAS: 63059-25-6)?

2-Iodobenzenesulfonic acid (CAS: 63059-25-6) is a chemical compound with the molecular formula C7H5I...

Compound Q&A

What are the main uses of 2-Iodobenzenesulfonic acid (CAS: 63059-25-6)?

2-Iodobenzenesulfonic acid is primarily used in the synthesis of other chemical compounds and as a r...

Compound Q&A

How should 2-Iodobenzenesulfonic acid (CAS: 63059-25-6) be stored?

2-Iodobenzenesulfonic acid (CAS: 63059-25-6) should be stored in a cool, dry place away from direct ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...