Compound Q&A

What are the main uses of 2-Iodobenzenesulfonic acid (CAS: 63059-25-6)?

Answer

2-Iodobenzenesulfonic acid
2-Iodobenzenesulfonic acid is primarily used in the synthesis of other chemical compounds and as a reagent in organic chemistry. It is also used in analytical chemistry for titration purposes and in the preparation of dyes and pigments.

About

CAS No 63059-25-6
English Name 2-Iodobenzenesulfonic acid
Molecular Formula C6H5IO3S
Molecular Weight 284.07 g/mol
SMILES C1=CC=C(C(=C1)S(=O)(=O)O)I
InChIKey ZJTNYBYLBTVLRD-UHFFFAOYSA-N
Last Updated: 2025-10-06 18:01

Related Q&A

Compound Q&A

What is 2-Iodobenzenesulfonic acid (CAS: 63059-25-6)?

2-Iodobenzenesulfonic acid (CAS: 63059-25-6) is a chemical compound with the molecular formula C7H5I...

Compound Q&A

Is 2-Iodobenzenesulfonic acid (CAS: 63059-25-6) safe?

2-Iodobenzenesulfonic acid (CAS: 63059-25-6) is generally considered safe when handled with appropri...

Compound Q&A

How should 2-Iodobenzenesulfonic acid (CAS: 63059-25-6) be stored?

2-Iodobenzenesulfonic acid (CAS: 63059-25-6) should be stored in a cool, dry place away from direct ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...