Compound Q&A

How is Fmoc-NH-PEG3-CH2CH2COOH (CAS: 867062-95-1) typically synthesized?

Answer

Fmoc-NH-PEG3-CH2CH2COOH
Fmoc-NH-PEG3-CH2CH2COOH is synthesized via a multi-step process involving the coupling of an amino acid to polyethylene glycol (PEG) using a coupling reagent like N-hydroxysuccinimide (NHS) and 1-ethyl-3-(3-dimethylaminopropyl) carbodiimide (EDC). The reaction is typically carried out in a polar aprotic solvent like N,N-Dimethylformamide (DMF) at room temperature or slightly elevated temperatures. The yield is generally high, with selectivity towards the amine coupling.

About

English Name Fmoc-NH-PEG3-CH2CH2COOH
Molecular Formula C24H29NO7
Molecular Weight 443.5 g/mol
SMILES OC(=O)CCOCCOCCOCCNC(=O)OCC1c2ccccc2-c3ccccc13
InChIKey CHIDDYZONKDHLG-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fmoc-NH-PEG3-CH2CH2COOH (CAS: 867062-95-1)?

Fmoc-NH-PEG3-CH2CH2COOH is a solid compound with a molecular weight of approximately 450.5 g/mol. It...

Compound Q&A

What industries use Fmoc-NH-PEG3-CH2CH2COOH (CAS: 867062-95-1)?

Fmoc-NH-PEG3-CH2CH2COOH is widely used in the pharmaceutical industry for the synthesis of peptides ...

Compound Q&A

What precautions should be taken when handling Fmoc-NH-PEG3-CH2CH2COOH (CAS: 867062-95-1)?

When handling Fmoc-NH-PEG3-CH2CH2COOH, it is essential to use appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...