Compound Q&A

What industries use Isochlorogenic acid A (CAS: 89919-62-0)?

Answer

Isochlorogenic acid A
Ichlorogenic acid A (CAS: 89919-62-0) is used in the pharmaceutical industry for its antioxidant and anti-inflammatory properties. It is also employed in the food industry as a natural preservative and in cosmetics for its skin-beneficial effects. Additionally, it finds applications in the polymer industry for enhancing mechanical properties and stability.

About

CAS No 89919-62-0
English Name Isochlorogenic acid A
Molecular Formula C25H24O12
Molecular Weight 516.46 g/mol
SMILES C1C(C(C(CC1(C(=O)O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O)O)OC(=O)C=CC3=CC(=C(C=C3)O)O
InChIKey KRZBCHWVBQOTNZ-JFZVQIRRSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Isochlorogenic acid A (CAS: 89919-62-0)?

Ichlorogenic acid A (CAS: 89919-62-0) is a colorless or white crystalline solid with a molecular wei...

Compound Q&A

How is Isochlorogenic acid A (CAS: 89919-62-0) typically synthesized?

Ichlorogenic acid A (CAS: 89919-62-0) is synthesized through a multi-step process involving the coup...

Compound Q&A

What precautions should be taken when handling Isochlorogenic acid A (CAS: 89919-62-0)?

When handling Isochlorogenic acid A (CAS: 89919-62-0), it is essential to use appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...