Compound Q&A

What are the physical and chemical properties of Isochlorogenic acid A (CAS: 89919-62-0)?

Answer

Isochlorogenic acid A
Ichlorogenic acid A (CAS: 89919-62-0) is a colorless or white crystalline solid with a molecular weight of approximately 354.2 g/mol. It is slightly soluble in water but more soluble in ethanol. Chemically, it is highly reactive due to its phenolic hydroxyl groups, which can undergo esterification and other reactions under appropriate conditions.

About

CAS No 89919-62-0
English Name Isochlorogenic acid A
Molecular Formula C25H24O12
Molecular Weight 516.46 g/mol
SMILES C1C(C(C(CC1(C(=O)O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O)O)OC(=O)C=CC3=CC(=C(C=C3)O)O
InChIKey KRZBCHWVBQOTNZ-JFZVQIRRSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is Isochlorogenic acid A (CAS: 89919-62-0) typically synthesized?

Ichlorogenic acid A (CAS: 89919-62-0) is synthesized through a multi-step process involving the coup...

Compound Q&A

What industries use Isochlorogenic acid A (CAS: 89919-62-0)?

Ichlorogenic acid A (CAS: 89919-62-0) is used in the pharmaceutical industry for its antioxidant and...

Compound Q&A

What precautions should be taken when handling Isochlorogenic acid A (CAS: 89919-62-0)?

When handling Isochlorogenic acid A (CAS: 89919-62-0), it is essential to use appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...