Compound Q&A

How is Xylanase (CAS: 9025-57-4) typically synthesized?

Answer

Xylanase, endo-1,4-b-
Xylanase (CAS: 9025-57-4) can be produced through fermentation using bacterial or fungal strains. Commonly, the enzyme is synthesized using the fungus Trichoderma reesei. The process involves culturing the microorganism in a suitable medium, followed by isolation and purification of the enzyme. The synthesis is optimized for yield and selectivity, often employing genetic engineering techniques to enhance enzyme production.

About

CAS No 9025-57-4
English Name Xylanase, endo-1,4-b-
Molecular Formula C34H50N4O2+2
Molecular Weight 546.8 g/mol
EINECS 232-800-2
SMILES CC[N+](CC)(CCCNC1=CC(=O)C(=CC1=O)NCCC[N+](CC)(CC)CC2=CC=CC=C2)CC3=CC=CC=C3
InChIKey YERABYSOHUZTPQ-UHFFFAOYSA-P
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Xylanase (CAS: 9025-57-4)?

Xylanase (CAS: 9025-57-4) is an enzyme characterized by its ability to break down xylan, a component...

Compound Q&A

What industries use Xylanase (CAS: 9025-57-4)?

Xylanase (CAS: 9025-57-4) finds application in various industries. In the food industry, it improves...

Compound Q&A

What precautions should be taken when handling Xylanase (CAS: 9025-57-4)?

When handling Xylanase (CAS: 9025-57-4), it is important to follow standard laboratory safety protoc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...