Compound Q&A

What are the physical and chemical properties of Xylanase (CAS: 9025-57-4)?

Answer

Xylanase, endo-1,4-b-
Xylanase (CAS: 9025-57-4) is an enzyme characterized by its ability to break down xylan, a component of plant cell walls. It is typically crystalline in form and has a molecular weight of around 50 kDa. Xylanase is moderately soluble in water and exhibits high thermal stability, making it suitable for various industrial applications. The enzyme is known for its specific reactivity towards xylan, showing little activity towards other substrates.

About

CAS No 9025-57-4
English Name Xylanase, endo-1,4-b-
Molecular Formula C34H50N4O2+2
Molecular Weight 546.8 g/mol
EINECS 232-800-2
SMILES CC[N+](CC)(CCCNC1=CC(=O)C(=CC1=O)NCCC[N+](CC)(CC)CC2=CC=CC=C2)CC3=CC=CC=C3
InChIKey YERABYSOHUZTPQ-UHFFFAOYSA-P
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is Xylanase (CAS: 9025-57-4) typically synthesized?

Xylanase (CAS: 9025-57-4) can be produced through fermentation using bacterial or fungal strains. Co...

Compound Q&A

What industries use Xylanase (CAS: 9025-57-4)?

Xylanase (CAS: 9025-57-4) finds application in various industries. In the food industry, it improves...

Compound Q&A

What precautions should be taken when handling Xylanase (CAS: 9025-57-4)?

When handling Xylanase (CAS: 9025-57-4), it is important to follow standard laboratory safety protoc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...