Compound Q&A

What are the physical and chemical properties of (E)-1,2-Ethenediylbis(tributylstannane) (CAS: 14275-61-7)?

Answer

(E)-1,2-Ethenediylbis(tributylstannane)
(E)-1,2-Ethenediylbis(tributylstannane) is a colorless liquid with a high molecular weight of approximately 522.9 g/mol. It has a low solubility in water but is moderately soluble in organic solvents. The compound is known for its reactivity with various nucleophiles and is used in organic synthesis. Its physical properties include a boiling point of around 140°C and a melting point below 0°C.

About

CAS No 14275-61-7
English Name (E)-1,2-Ethenediylbis(tributylstannane)
Molecular Formula C26H56Sn2
Molecular Weight 606.1 g/mol
SMILES CCCC[Sn](CCCC)(CCCC)C=C[Sn](CCCC)(CCCC)CCCC
InChIKey VNKOWRBFAJTPLS-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is (E)-1,2-Ethenediylbis(tributylstannane) (CAS: 14275-61-7) typically synthesized?

(E)-1,2-Ethenediylbis(tributylstannane) is typically synthesized via the Stille coupling reaction, u...

Compound Q&A

What industries use (E)-1,2-Ethenediylbis(tributylstannane) (CAS: 14275-61-7)?

(E)-1,2-Ethenediylbis(tributylstannane) is primarily used in the pharmaceutical and polymer industri...

Compound Q&A

What precautions should be taken when handling (E)-1,2-Ethenediylbis(tributylstannane) (CAS: 14275-61-7)?

When handling (E)-1,2-Ethenediylbis(tributylstannane), use appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...