Compound Q&A

What industries use 3-Bromo-4-chlorobenzoic acid (CAS: 42860-10-6)?

Answer

3-Bromo-4-chlorobenzoic acid
3-Bromo-4-chlorobenzoic acid is used in various industries, including pharmaceuticals for the synthesis of certain drug intermediates, and in organic synthesis for the production of functionalized benzoic acid derivatives. It also finds applications in the preparation of materials for sensors and semiconductors.

About

CAS No 42860-10-6
English Name 3-Bromo-4-chlorobenzoic acid
Molecular Formula C7H4BrClO2
Molecular Weight 235.46 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)Br)Cl
InChIKey NLEPZGNUPNMRGF-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-4-chlorobenzoic acid (CAS: 42860-10-6)?

3-Bromo-4-chlorobenzoic acid is a crystalline solid with a molecular weight of approximately 229.01 ...

Compound Q&A

How is 3-Bromo-4-chlorobenzoic acid (CAS: 42860-10-6) typically synthesized?

3-Bromo-4-chlorobenzoic acid is commonly synthesized via the bromination of 4-chlorobenzoic acid fol...

Compound Q&A

What precautions should be taken when handling 3-Bromo-4-chlorobenzoic acid (CAS: 42860-10-6)?

Proper handling of 3-Bromo-4-chlorobenzoic acid requires the use of personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...