Compound Q&A

How is 3-Bromo-4-chlorobenzoic acid (CAS: 42860-10-6) typically synthesized?

Answer

3-Bromo-4-chlorobenzoic acid
3-Bromo-4-chlorobenzoic acid is commonly synthesized via the bromination of 4-chlorobenzoic acid followed by recrystallization. The synthesis typically uses N-bromosuccinimide (NBS) as a brominating agent in the presence of an appropriate base such as potassium carbonate. The reaction yields up to 80% of the desired product, with good selectivity.

About

CAS No 42860-10-6
English Name 3-Bromo-4-chlorobenzoic acid
Molecular Formula C7H4BrClO2
Molecular Weight 235.46 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)Br)Cl
InChIKey NLEPZGNUPNMRGF-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-4-chlorobenzoic acid (CAS: 42860-10-6)?

3-Bromo-4-chlorobenzoic acid is a crystalline solid with a molecular weight of approximately 229.01 ...

Compound Q&A

What industries use 3-Bromo-4-chlorobenzoic acid (CAS: 42860-10-6)?

3-Bromo-4-chlorobenzoic acid is used in various industries, including pharmaceuticals for the synthe...

Compound Q&A

What precautions should be taken when handling 3-Bromo-4-chlorobenzoic acid (CAS: 42860-10-6)?

Proper handling of 3-Bromo-4-chlorobenzoic acid requires the use of personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...