Compound Q&A

What industries use 3-Oxetanyl 4-methylbenzenesulfonate (CAS: 26272-83-3)?

Answer

3-Oxetanyl 4-methylbenzenesulfonate
3-Oxetanyl 4-methylbenzenesulfonate is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those that require specific functional groups. It is also utilized in the polymer industry for modifying the properties of polymers, and in the sensor industry for developing chemically sensitive materials.

About

CAS No 26272-83-3
English Name 3-Oxetanyl 4-methylbenzenesulfonate
Molecular Formula C10H12O4S
Molecular Weight 228.27 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OC2COC2
InChIKey UMFWNFVHKAJOSE-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Oxetanyl 4-methylbenzenesulfonate (CAS: 26272-83-3)?

3-Oxetanyl 4-methylbenzenesulfonate is a crystalline compound with a molecular weight of approximate...

Compound Q&A

How is 3-Oxetanyl 4-methylbenzenesulfonate (CAS: 26272-83-3) typically synthesized?

3-Oxetanyl 4-methylbenzenesulfonate is typically synthesized by the reaction of 4-methylbenzenesulfo...

Compound Q&A

What precautions should be taken when handling 3-Oxetanyl 4-methylbenzenesulfonate (CAS: 26272-83-3)?

When handling 3-Oxetanyl 4-methylbenzenesulfonate, it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...