Compound Q&A

How is 3-Oxetanyl 4-methylbenzenesulfonate (CAS: 26272-83-3) typically synthesized?

Answer

3-Oxetanyl 4-methylbenzenesulfonate
3-Oxetanyl 4-methylbenzenesulfonate is typically synthesized by the reaction of 4-methylbenzenesulfonyl chloride with 3-oxetanol. The reaction is usually conducted in the presence of a base such as pyridine to enhance the nucleophilicity of 3-oxetanol. The yield is typically around 75-80%, and the product is isolated via recrystallization.

About

CAS No 26272-83-3
English Name 3-Oxetanyl 4-methylbenzenesulfonate
Molecular Formula C10H12O4S
Molecular Weight 228.27 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OC2COC2
InChIKey UMFWNFVHKAJOSE-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Oxetanyl 4-methylbenzenesulfonate (CAS: 26272-83-3)?

3-Oxetanyl 4-methylbenzenesulfonate is a crystalline compound with a molecular weight of approximate...

Compound Q&A

What industries use 3-Oxetanyl 4-methylbenzenesulfonate (CAS: 26272-83-3)?

3-Oxetanyl 4-methylbenzenesulfonate is used in the pharmaceutical industry for the synthesis of cert...

Compound Q&A

What precautions should be taken when handling 3-Oxetanyl 4-methylbenzenesulfonate (CAS: 26272-83-3)?

When handling 3-Oxetanyl 4-methylbenzenesulfonate, it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...