Compound Q&A

What precautions should be taken when handling 2-[4-({4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl}oxy)-1-piperidinyl]-N-methylacetamide (CAS: 848942-61-0)?

Answer

2-[4-({4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl}oxy)-1-piperidinyl]-N-methylacetamide
Proper personal protective equipment (PPE) including gloves, goggles, and lab coat should be worn at all times. This compound should be handled in a fume hood to minimize exposure. In case of spills, neutralize with an appropriate chemical neutralizer before cleaning up. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name 2-[4-({4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl}oxy)-1-piperidinyl]-N-methylacetamide
Molecular Formula C23H25ClFN5O3
Molecular Weight 473.94 g/mol
SMILES CNC(=O)CN1CCC(CC1)Oc1cc2c(ncnc2cc1OC)Nc1cccc(c1F)Cl
InChIKey DFJSJLGUIXFDJP-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[4-({4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl}oxy)-1-piperidinyl]-N-methylacetamide (CAS: 848942-61-0)?

The compound is a crystalline solid with a molecular weight of approximately 601.74 g/mol. It has a ...

Compound Q&A

How is 2-[4-({4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl}oxy)-1-piperidinyl]-N-methylacetamide (CAS: 848942-61-0) typically synthesized?

The compound is synthesized via a multi-step process involving the coupling of quinazoline and piper...

Compound Q&A

What industries use 2-[4-({4-[(3-Chloro-2-fluorophenyl)amino]-7-methoxy-6-quinazolinyl}oxy)-1-piperidinyl]-N-methylacetamide (CAS: 848942-61-0)?

This compound is primarily used in the pharmaceutical industry for its potential therapeutic applica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...