Compound Q&A

How is dibenzo[b,d]furan-3-ylboronic acid (CAS: 395087-89-5) typically synthesized?

Answer

Dibenzo[b,d]furan-3-ylboronic acid
Dibenzo[b,d]furan-3-ylboronic acid can be synthesized via a multistep process involving the preparation of dibenzo[b,d]furan and subsequent protection with a boronic acid derivative. Commonly, this involves a combination of Suzuki coupling reactions and esterification steps, often using catalysis with palladium and base conditions. The reaction typically yields a high purity product with good selectivity and yield.

About

English Name Dibenzo[b,d]furan-3-ylboronic acid
Molecular Formula C12H9BO3
Molecular Weight 212.01 g/mol
SMILES B(C1=CC2=C(C=C1)C3=CC=CC=C3O2)(O)O
InChIKey FQENSZQWKVWYPA-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dibenzo[b,d]furan-3-ylboronic acid (CAS: 395087-89-5)?

Dibenzo[b,d]furan-3-ylboronic acid is a solid with a crystalline form. It has a molecular weight of ...

Compound Q&A

What industries use dibenzo[b,d]furan-3-ylboronic acid (CAS: 395087-89-5)?

Dibenzo[b,d]furan-3-ylboronic acid finds applications in various industries, particularly in pharmac...

Compound Q&A

What precautions should be taken when handling dibenzo[b,d]furan-3-ylboronic acid (CAS: 395087-89-5)?

When handling dibenzo[b,d]furan-3-ylboronic acid, it is important to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...