Compound Q&A

What are the physical and chemical properties of (11beta,16alpha)-11,16,17-Trihydroxy-3,20-dioxopregna-1,4-dien-21-yl acetate (CAS: 86401-80-1)?

Answer

(11beta,16alpha)-11,16,17-Trihydroxy-3,20-dioxopregna-1,4-dien-21-yl acetate
(11beta,16alpha)-11,16,17-Trihydroxy-3,20-dioxopregna-1,4-dien-21-yl acetate is an organic compound with a molecular weight of approximately 426.45 g/mol. It has a crystalline form at room temperature and is poorly soluble in water. The compound exhibits a high reactivity due to the presence of hydroxyl and carbonyl groups, making it susceptible to hydrolysis and oxidation. It is stable under anhydrous and neutral conditions but should be stored under conditions that minimize moisture and oxygen exposure.

About

CAS No 86401-80-1
English Name (11beta,16alpha)-11,16,17-Trihydroxy-3,20-dioxopregna-1,4-dien-21-yl acetate
Molecular Formula C23H30O7
Molecular Weight 418.49 g/mol
SMILES CC(=O)OCC(=O)[C@]1([C@@H](C[C@@H]2[C@@]1(C[C@@H]([C@H]3[C@H]2CCC4=CC(=O)C=C[C@]34C)O)C)O)O
InChIKey AAMGSJIEPUHTOK-GIMXSRRZSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is (11beta,16alpha)-11,16,17-Trihydroxy-3,20-dioxopregna-1,4-dien-21-yl acetate (CAS: 86401-80-1) typically synthesized?

(11beta,16alpha)-11,16,17-Trihydroxy-3,20-dioxopregna-1,4-dien-21-yl acetate is typically synthesize...

Compound Q&A

What industries use (11beta,16alpha)-11,16,17-Trihydroxy-3,20-dioxopregna-1,4-dien-21-yl acetate (CAS: 86401-80-1)?

(11beta,16alpha)-11,16,17-Trihydroxy-3,20-dioxopregna-1,4-dien-21-yl acetate is primarily used in th...

Compound Q&A

What precautions should be taken when handling (11beta,16alpha)-11,16,17-Trihydroxy-3,20-dioxopregna-1,4-dien-21-yl acetate (CAS: 86401-80-1)?

When handling (11beta,16alpha)-11,16,17-Trihydroxy-3,20-dioxopregna-1,4-dien-21-yl acetate, it is es...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...