Compound Q&A

What industries use 4-Bromo-N-phenylaniline (CAS: 54446-36-5)?

Answer

4-Bromo-N-phenylaniline
4-Bromo-N-phenylaniline (CAS: 54446-36-5) is used in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It also finds applications in the polymer industry for the production of specific polymers and in the development of sensors due to its reactivity and stability under specific conditions. Additionally, it is utilized in the semiconductor industry for its unique electronic properties.

About

CAS No 54446-36-5
English Name 4-Bromo-N-phenylaniline
Molecular Formula C12H10BrN
Molecular Weight 248.12 g/mol
SMILES C1=CC=C(C=C1)NC2=CC=C(C=C2)Br
InChIKey CCIVUDMVXNBUCY-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-N-phenylaniline (CAS: 54446-36-5)?

4-Bromo-N-phenylaniline (CAS: 54446-36-5) is a crystalline solid with a molecular weight of approxim...

Compound Q&A

How is 4-Bromo-N-phenylaniline (CAS: 54446-36-5) typically synthesized?

4-Bromo-N-phenylaniline is typically synthesized by reacting anisidine with bromine in the presence ...

Compound Q&A

What precautions should be taken when handling 4-Bromo-N-phenylaniline (CAS: 54446-36-5)?

When handling 4-Bromo-N-phenylaniline (CAS: 54446-36-5), it is essential to use personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...