Compound Q&A

What industries use (17beta)-3-Oxoestra-4,6-dien-17-yl acetate (CAS: 2590-41-2)?

Answer

(17beta)-3-Oxoestra-4,6-dien-17-yl acetate
The compound (17beta)-3-Oxoestra-4,6-dien-17-yl acetate is primarily used in the pharmaceutical industry as a precursor for hormone synthesis. It also finds applications in the production of certain types of polymers and as a reagent in organic synthesis for research purposes. Its use in the semiconductor industry is limited due to its biological nature, but it can be utilized in the development of biosensors.

About

CAS No 2590-41-2
English Name (17beta)-3-Oxoestra-4,6-dien-17-yl acetate
Molecular Formula C20H26O3
Molecular Weight 314.43 g/mol
SMILES CC(=O)OC1CCC2C1(CCC3C2C=CC4=CC(=O)CCC34)C
InChIKey OGUASZAAVFYYIL-XGXHKTLJSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of (17beta)-3-Oxoestra-4,6-dien-17-yl acetate (CAS: 2590-41-2)?

The compound (17beta)-3-Oxoestra-4,6-dien-17-yl acetate has a crystalline form at room temperature. ...

Compound Q&A

How is (17beta)-3-Oxoestra-4,6-dien-17-yl acetate (CAS: 2590-41-2) typically synthesized?

The compound (17beta)-3-Oxoestra-4,6-dien-17-yl acetate is typically synthesized through esterificat...

Compound Q&A

What precautions should be taken when handling (17beta)-3-Oxoestra-4,6-dien-17-yl acetate (CAS: 2590-41-2)?

When handling (17beta)-3-Oxoestra-4,6-dien-17-yl acetate, it is crucial to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...