Compound Q&A

What are the physical and chemical properties of (17beta)-3-Oxoestra-4,6-dien-17-yl acetate (CAS: 2590-41-2)?

Answer

(17beta)-3-Oxoestra-4,6-dien-17-yl acetate
The compound (17beta)-3-Oxoestra-4,6-dien-17-yl acetate has a crystalline form at room temperature. Its molecular weight is approximately 298.4 g/mol. It is slightly soluble in water but readily soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can undergo hydrolysis in the presence of strong acids or bases. It does not exhibit significant reactivity towards common functional group transformations without appropriate conditions.

About

CAS No 2590-41-2
English Name (17beta)-3-Oxoestra-4,6-dien-17-yl acetate
Molecular Formula C20H26O3
Molecular Weight 314.43 g/mol
SMILES CC(=O)OC1CCC2C1(CCC3C2C=CC4=CC(=O)CCC34)C
InChIKey OGUASZAAVFYYIL-XGXHKTLJSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

How is (17beta)-3-Oxoestra-4,6-dien-17-yl acetate (CAS: 2590-41-2) typically synthesized?

The compound (17beta)-3-Oxoestra-4,6-dien-17-yl acetate is typically synthesized through esterificat...

Compound Q&A

What industries use (17beta)-3-Oxoestra-4,6-dien-17-yl acetate (CAS: 2590-41-2)?

The compound (17beta)-3-Oxoestra-4,6-dien-17-yl acetate is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling (17beta)-3-Oxoestra-4,6-dien-17-yl acetate (CAS: 2590-41-2)?

When handling (17beta)-3-Oxoestra-4,6-dien-17-yl acetate, it is crucial to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...