Compound Q&A

What precautions should be taken when handling 3-Amino-2,6-difluorobenzoic acid (CAS: 83141-11-1)?

Answer

3-Amino-2,6-difluorobenzoic acid
When handling 3-Amino-2,6-difluorobenzoic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood. Spills should be cleaned up immediately following the manufacturer's safety data sheet (SDS) guidelines. Storage should be in a cool, dry place away from incompatible materials.

About

CAS No 83141-11-1
English Name 3-Amino-2,6-difluorobenzoic acid
Molecular Formula C7H5F2NO2
Molecular Weight 173.12 g/mol
SMILES C1=CC(=C(C(=C1N)F)C(=O)O)F
InChIKey ORSUTLAFOCNIDY-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-2,6-difluorobenzoic acid (CAS: 83141-11-1)?

3-Amino-2,6-difluorobenzoic acid is a solid at room temperature. It has a molecular weight of approx...

Compound Q&A

How is 3-Amino-2,6-difluorobenzoic acid (CAS: 83141-11-1) typically synthesized?

3-Amino-2,6-difluorobenzoic acid is typically synthesized via a multistep process involving the synt...

Compound Q&A

What industries use 3-Amino-2,6-difluorobenzoic acid (CAS: 83141-11-1)?

3-Amino-2,6-difluorobenzoic acid is primarily used in pharmaceuticals, where it serves as an interme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...