Compound Q&A

What industries use 3-Amino-2,6-difluorobenzoic acid (CAS: 83141-11-1)?

Answer

3-Amino-2,6-difluorobenzoic acid
3-Amino-2,6-difluorobenzoic acid is primarily used in pharmaceuticals, where it serves as an intermediate in the synthesis of various drugs. It is also applied in the production of polymers and other materials that require specific functional groups. Its use in sensors and semiconductors is also notable due to its chemical properties.

About

CAS No 83141-11-1
English Name 3-Amino-2,6-difluorobenzoic acid
Molecular Formula C7H5F2NO2
Molecular Weight 173.12 g/mol
SMILES C1=CC(=C(C(=C1N)F)C(=O)O)F
InChIKey ORSUTLAFOCNIDY-UHFFFAOYSA-N
Last Updated: 2025-10-05 08:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-2,6-difluorobenzoic acid (CAS: 83141-11-1)?

3-Amino-2,6-difluorobenzoic acid is a solid at room temperature. It has a molecular weight of approx...

Compound Q&A

How is 3-Amino-2,6-difluorobenzoic acid (CAS: 83141-11-1) typically synthesized?

3-Amino-2,6-difluorobenzoic acid is typically synthesized via a multistep process involving the synt...

Compound Q&A

What precautions should be taken when handling 3-Amino-2,6-difluorobenzoic acid (CAS: 83141-11-1)?

When handling 3-Amino-2,6-difluorobenzoic acid, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...